Urolithin B (1139-83-9) Pabrik pembuat

Urolithin B

November 9, 2020

Urolithin BSpecifications

Nama: Urolithin B
Nama kimia: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Formula kimia: C13H8O3
Berat molekul: X
Warna:  Bubuk putih
Kunci InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Kode SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Fungsi: Urolithin B dapat meningkatkan fungsi mitokondria dan otot.

Urolithin B dapat meningkatkan kekuatan dan daya tahan otot selama penuaan.

Aplikasi: Urolithin B adalah metabolit mikroba usus dari ellagitannis dan menunjukkan aktivitas anti-oksidan dan pro-oksidan yang kuat tergantung pada sistem dan kondisi pengujian. Urolithin B juga dapat menunjukkan aktivitas estrogenik dan / atau anti-estrogenik.
Kelarutan: Mudah larut dalam N, N-dimethylformamide dan dimethylmethylene. Sulfone, sedikit larut dalam metanol, etanol, dan etil asetat
Suhu penyimpanan: Hygroscopic, -20 ° C Freezer, Di bawah atmosfer inert
Kondisi Pengiriman: Dikirim di bawah suhu kamar sebagai bahan kimia yang tidak berbahaya. Produk ini cukup stabil selama beberapa minggu selama pengiriman biasa dan waktu yang dihabiskan di Bea Cukai.